About methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate
methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate (PubChem CID 87886809) has the molecular formula C14H25NO4
and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate.
Molecular Properties
| Compound Name | methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate |
| PubChem CID | 87886809 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate |
| SMILES | C=C(C)C(C)CC(NC(=O)OCCCC)C(=O)OC |
| InChI | InChI=1S/C14H25NO4/c1-6-7-8-19-14(17)15-12(13(16)18-5)9-11(4)10(2)3/h11-12H,2,6-9H2,1,3-5H3,(H,15,17) |
| InChIKey | XWMSNMOAAWWXHW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate?
The IUPAC name of methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate (CID 87886809) is methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate.
What is the SMILES notation for methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate?
The canonical SMILES for methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate is C=C(C)C(C)CC(NC(=O)OCCCC)C(=O)OC.
What is the InChIKey of methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate?
The InChIKey is XWMSNMOAAWWXHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO4/c1-6-7-8-19-14(17)15-12(13(16)18-5)9-11(4)10(2)3/h11-12H,2,6-9H2,1,3-5H3,(H,15,17).
What are the key properties of methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate?
methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate has a molecular weight of 271.36 g/mol, XLogP of 2.66, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(butoxycarbonylamino)-4,5-dimethylhex-5-enoate is sourced from PubChem (CID 87886809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).