About 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate
2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate (PubChem CID 87886925) has the molecular formula C13H17NO6S
and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate |
| PubChem CID | 87886925 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate |
| SMILES | Cc1ccc(O)cc1S(=O)(=O)OCCN1C[C@H](C)OC1=O |
| InChI | InChI=1S/C13H17NO6S/c1-9-3-4-11(15)7-12(9)21(17,18)19-6-5-14-8-10(2)20-13(14)16/h3-4,7,10,15H,5-6,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | UXJNNLIKCKEYQQ-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate?
The IUPAC name of 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate (CID 87886925) is 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate.
What is the SMILES notation for 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate?
The canonical SMILES for 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate is Cc1ccc(O)cc1S(=O)(=O)OCCN1C[C@H](C)OC1=O.
What is the InChIKey of 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate?
The InChIKey is UXJNNLIKCKEYQQ-JTQLQIEISA-N. The full InChI is InChI=1S/C13H17NO6S/c1-9-3-4-11(15)7-12(9)21(17,18)19-6-5-14-8-10(2)20-13(14)16/h3-4,7,10,15H,5-6,8H2,1-2H3/t10-/m0/s1.
What are the key properties of 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate?
2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate has a molecular weight of 315.35 g/mol, XLogP of 1.25, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethyl 5-hydroxy-2-methylbenzenesulfonate is sourced from PubChem (CID 87886925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).