C13H21NO4S — CID 87886943
1-benzylpiperidin-3-ol;methanesulfonic acid (PubChem CID 87886943) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is 1-benzylpiperidin-3-ol;methanesulfonic acid.
| Compound Name | 1-benzylpiperidin-3-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 87886943 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-benzylpiperidin-3-ol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C12H17NO.CH4O3S/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11;1-5(2,3)4/h1-3,5-6,12,14H,4,7-10H2;1H3,(H,2,3,4) |
| InChIKey | UJHOUFLXIJLLQA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|