C23H20Cl3FN6O — CID 87887080
5-(4-chlorophenyl)-N-cyano-N-[2-(2,4-dichlorophenyl)-2-fluoroethyl]-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 87887080) has the molecular formula C23H20Cl3FN6O and a molecular weight of 521.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyano-N-[2-(2,4-dichlorophenyl)-2-fluoroethyl]-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyano-N-[2-(2,4-dichlorophenyl)-2-fluoroethyl]-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 87887080 |
| Molecular Formula | C23H20Cl3FN6O |
| Molecular Weight | 521.81 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyano-N-[2-(2,4-dichlorophenyl)-2-fluoroethyl]-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | [H]/N=C(/N(C#N)CC(F)c1ccc(Cl)cc1Cl)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H20Cl3FN6O/c24-15-5-3-14(4-6-15)22-20(32-9-1-2-21(32)34)12-33(30-22)23(29)31(13-28)11-19(27)17-8-7-16(25)10-18(17)26/h3-8,10,19-20,29H,1-2,9,11-12H2/b29-23- |
| InChIKey | QVJHBSGRMTWLEQ-FAJYDZGRSA-N |
| XLogP | 5.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.81 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|