C34H38Cl2F3N5O4 — CID 87887356
2-[4-[4,5-bis(4-chlorophenyl)-2-[2-ethoxy-4-(trifluoromethyl)phenyl]imidazolidine-2-carbonyl]piperazin-1-yl]-2-(2-methoxyethylamino)acetaldehyde (PubChem CID 87887356) has the molecular formula C34H38Cl2F3N5O4 and a molecular weight of 708.61 g/mol. Its IUPAC name is 2-[4-[4,5-bis(4-chlorophenyl)-2-[2-ethoxy-4-(trifluoromethyl)phenyl]imidazolidine-2-carbonyl]piperazin-1-yl]-2-(2-methoxyethylamino)acetaldehyde.
| Compound Name | 2-[4-[4,5-bis(4-chlorophenyl)-2-[2-ethoxy-4-(trifluoromethyl)phenyl]imidazolidine-2-carbonyl]piperazin-1-yl]-2-(2-methoxyethylamino)acetaldehyde |
|---|---|
| PubChem CID | 87887356 |
| Molecular Formula | C34H38Cl2F3N5O4 |
| Molecular Weight | 708.61 g/mol |
| Exact Mass | 707.23 |
| IUPAC Name | 2-[4-[4,5-bis(4-chlorophenyl)-2-[2-ethoxy-4-(trifluoromethyl)phenyl]imidazolidine-2-carbonyl]piperazin-1-yl]-2-(2-methoxyethylamino)acetaldehyde |
| SMILES | CCOc1cc(C(F)(F)F)ccc1C1(C(=O)N2CCN(C(C=O)NCCOC)CC2)NC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C34H38Cl2F3N5O4/c1-3-48-28-20-24(34(37,38)39)8-13-27(28)33(32(46)44-17-15-43(16-18-44)29(21-45)40-14-19-47-2)41-30(22-4-9-25(35)10-5-22)31(42-33)23-6-11-26(36)12-7-23/h4-13,20-21,29-31,40-42H,3,14-19H2,1-2H3 |
| InChIKey | QZXFGWNEZBPJCC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|