About chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one
chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one (PubChem CID 87887550) has the molecular formula C28H22O6
and a molecular weight of 454.48 g/mol. Its IUPAC name is chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one.
Molecular Properties
| Compound Name | chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one |
| PubChem CID | 87887550 |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one |
| SMILES | CC(=O)CC(c1ccccc1)c1c(O)c2ccccc2oc1=O.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C19H16O4.C9H6O2/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22;10-9-6-5-7-3-1-2-4-8(7)11-9/h2-10,15,21H,11H2,1H3;1-6H |
| InChIKey | BAUNWTWNMPCQRC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one?
The IUPAC name of chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one (CID 87887550) is chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one.
What is the SMILES notation for chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one?
The canonical SMILES for chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one is CC(=O)CC(c1ccccc1)c1c(O)c2ccccc2oc1=O.O=c1ccc2ccccc2o1.
What is the InChIKey of chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one?
The InChIKey is BAUNWTWNMPCQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O4.C9H6O2/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22;10-9-6-5-7-3-1-2-4-8(7)11-9/h2-10,15,21H,11H2,1H3;1-6H.
What are the key properties of chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one?
chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one has a molecular weight of 454.48 g/mol, XLogP of 5.40, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-one;4-hydroxy-3-(3-oxo-1-phenylbutyl)chromen-2-one is sourced from PubChem (CID 87887550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).