C16H32N6S2 — CID 87887610
N-[2-[2-[(1,3-dimethyl-1,3-diazinan-2-ylidene)amino]ethyldisulfanyl]ethyl]-1,3-dimethyl-1,3-diazinan-2-imine (PubChem CID 87887610) has the molecular formula C16H32N6S2 and a molecular weight of 372.61 g/mol. Its IUPAC name is N-[2-[2-[(1,3-dimethyl-1,3-diazinan-2-ylidene)amino]ethyldisulfanyl]ethyl]-1,3-dimethyl-1,3-diazinan-2-imine.
| Compound Name | N-[2-[2-[(1,3-dimethyl-1,3-diazinan-2-ylidene)amino]ethyldisulfanyl]ethyl]-1,3-dimethyl-1,3-diazinan-2-imine |
|---|---|
| PubChem CID | 87887610 |
| Molecular Formula | C16H32N6S2 |
| Molecular Weight | 372.61 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-[2-[2-[(1,3-dimethyl-1,3-diazinan-2-ylidene)amino]ethyldisulfanyl]ethyl]-1,3-dimethyl-1,3-diazinan-2-imine |
| SMILES | CN1CCCN(C)C1=NCCSSCCN=C1N(C)CCCN1C |
| InChI | InChI=1S/C16H32N6S2/c1-19-9-5-10-20(2)15(19)17-7-13-23-24-14-8-18-16-21(3)11-6-12-22(16)4/h5-14H2,1-4H3 |
| InChIKey | MCGYNMRNKLIUNI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.61 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|