C38H22Cl4N4O7 — CID 87887897
5,6-bis(4-chlorophenyl)-3-ethoxycarbonylpyrazine-2-carboxylic acid;2,3-bis(4-chlorophenyl)furo[3,4-b]pyrazine-5,7-dione (PubChem CID 87887897) has the molecular formula C38H22Cl4N4O7 and a molecular weight of 788.43 g/mol. Its IUPAC name is 5,6-bis(4-chlorophenyl)-3-ethoxycarbonylpyrazine-2-carboxylic acid;2,3-bis(4-chlorophenyl)furo[3,4-b]pyrazine-5,7-dione.
| Compound Name | 5,6-bis(4-chlorophenyl)-3-ethoxycarbonylpyrazine-2-carboxylic acid;2,3-bis(4-chlorophenyl)furo[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 87887897 |
| Molecular Formula | C38H22Cl4N4O7 |
| Molecular Weight | 788.43 g/mol |
| Exact Mass | 786.02 |
| IUPAC Name | 5,6-bis(4-chlorophenyl)-3-ethoxycarbonylpyrazine-2-carboxylic acid;2,3-bis(4-chlorophenyl)furo[3,4-b]pyrazine-5,7-dione |
| SMILES | CCOC(=O)c1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nc1C(=O)O.O=C1OC(=O)c2nc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)nc21 |
| InChI | InChI=1S/C20H14Cl2N2O4.C18H8Cl2N2O3/c1-2-28-20(27)18-17(19(25)26)23-15(11-3-7-13(21)8-4-11)16(24-18)12-5-9-14(22)10-6-12;19-11-5-1-9(2-6-11)13-14(10-3-7-12(20)8-4-10)22-16-15(21-13)17(23)25-18(16)24/h3-10H,2H2,1H3,(H,25,26);1-8H |
| InChIKey | AOGMPKWLOMVWSF-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 158.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.43 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|