C23H30N4O10S — CID 87887903
2-amino-5-[[1-(carboxymethylamino)-3-[3-[methoxy-(3-oxo-2-phenylpropyl)amino]-2,3-dioxopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 87887903) has the molecular formula C23H30N4O10S and a molecular weight of 554.58 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-3-[3-[methoxy-(3-oxo-2-phenylpropyl)amino]-2,3-dioxopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-3-[3-[methoxy-(3-oxo-2-phenylpropyl)amino]-2,3-dioxopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87887903 |
| Molecular Formula | C23H30N4O10S |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-3-[3-[methoxy-(3-oxo-2-phenylpropyl)amino]-2,3-dioxopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CON(CC(C=O)c1ccccc1)C(=O)C(=O)CSCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H30N4O10S/c1-37-27(10-15(11-28)14-5-3-2-4-6-14)22(34)18(29)13-38-12-17(21(33)25-9-20(31)32)26-19(30)8-7-16(24)23(35)36/h2-6,11,15-17H,7-10,12-13,24H2,1H3,(H,25,33)(H,26,30)(H,31,32)(H,35,36) |
| InChIKey | IOSZYPASNVPIBS-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 222.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|