C19H25N5O2S2 — CID 8788821
N-[2-[[2-(N-acetyl-2-ethylanilino)-1,3-thiazol-4-yl]methylcarbamothioylamino]ethyl]acetamide (PubChem CID 8788821) has the molecular formula C19H25N5O2S2 and a molecular weight of 419.58 g/mol. Its IUPAC name is N-[2-[[2-(N-acetyl-2-ethylanilino)-1,3-thiazol-4-yl]methylcarbamothioylamino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(N-acetyl-2-ethylanilino)-1,3-thiazol-4-yl]methylcarbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 8788821 |
| Molecular Formula | C19H25N5O2S2 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[2-[[2-(N-acetyl-2-ethylanilino)-1,3-thiazol-4-yl]methylcarbamothioylamino]ethyl]acetamide |
| SMILES | CCc1ccccc1N(C(C)=O)c1nc(CNC(=S)NCCNC(C)=O)cs1 |
| InChI | InChI=1S/C19H25N5O2S2/c1-4-15-7-5-6-8-17(15)24(14(3)26)19-23-16(12-28-19)11-22-18(27)21-10-9-20-13(2)25/h5-8,12H,4,9-11H2,1-3H3,(H,20,25)(H2,21,22,27) |
| InChIKey | WYAGLCUCCRVQIR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|