C16H18N2O2S — CID 87888270
N'-hydroxy-12-oxo-6,7,8,9,10,11-hexahydrocycloocta[b]thiochromene-3-carboximidamide (PubChem CID 87888270) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is N'-hydroxy-12-oxo-6,7,8,9,10,11-hexahydrocycloocta[b]thiochromene-3-carboximidamide.
| Compound Name | N'-hydroxy-12-oxo-6,7,8,9,10,11-hexahydrocycloocta[b]thiochromene-3-carboximidamide |
|---|---|
| PubChem CID | 87888270 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N'-hydroxy-12-oxo-6,7,8,9,10,11-hexahydrocycloocta[b]thiochromene-3-carboximidamide |
| SMILES | N/C(=N\O)c1ccc2c(=O)c3c(sc2c1)CCCCCC3 |
| InChI | InChI=1S/C16H18N2O2S/c17-16(18-20)10-7-8-12-14(9-10)21-13-6-4-2-1-3-5-11(13)15(12)19/h7-9,20H,1-6H2,(H2,17,18) |
| InChIKey | ATMOKHPFOHEJFC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|