C23H31F6N3O5 — CID 87888550
(9R,13R)-4-[1-(cyclopropylmethoxy)butyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87888550) has the molecular formula C23H31F6N3O5 and a molecular weight of 543.51 g/mol. Its IUPAC name is (9R,13R)-4-[1-(cyclopropylmethoxy)butyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (9R,13R)-4-[1-(cyclopropylmethoxy)butyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87888550 |
| Molecular Formula | C23H31F6N3O5 |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | (9R,13R)-4-[1-(cyclopropylmethoxy)butyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCCC(OCC1CC1)c1ccc2c(n1)N1[C@@H](CNC[C@H]1C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H29N3O.2C2HF3O2/c1-3-4-18(23-12-14-5-6-14)17-8-7-15-9-16-11-20-10-13(2)22(16)19(15)21-17;2*3-2(4,5)1(6)7/h7-8,13-14,16,18,20H,3-6,9-12H2,1-2H3;2*(H,6,7)/t13-,16-,18?;;/m1../s1 |
| InChIKey | UVESLMIPANVOQD-RSRJAMNESA-N |
| XLogP | 4.34 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |