C29H33N3O8S — CID 87888726
N-[4-[(2S)-2-hydroxy-3-[(2R,4S)-4-(4-methoxy-1-benzothiophen-2-yl)-2-methylpiperidin-1-yl]propoxy]-1H-indol-2-yl]formamide;oxalic acid (PubChem CID 87888726) has the molecular formula C29H33N3O8S and a molecular weight of 583.66 g/mol. Its IUPAC name is N-[4-[(2S)-2-hydroxy-3-[(2R,4S)-4-(4-methoxy-1-benzothiophen-2-yl)-2-methylpiperidin-1-yl]propoxy]-1H-indol-2-yl]formamide;oxalic acid.
| Compound Name | N-[4-[(2S)-2-hydroxy-3-[(2R,4S)-4-(4-methoxy-1-benzothiophen-2-yl)-2-methylpiperidin-1-yl]propoxy]-1H-indol-2-yl]formamide;oxalic acid |
|---|---|
| PubChem CID | 87888726 |
| Molecular Formula | C29H33N3O8S |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | N-[4-[(2S)-2-hydroxy-3-[(2R,4S)-4-(4-methoxy-1-benzothiophen-2-yl)-2-methylpiperidin-1-yl]propoxy]-1H-indol-2-yl]formamide;oxalic acid |
| SMILES | COc1cccc2sc([C@H]3CCN(C[C@H](O)COc4cccc5[nH]c(NC=O)cc45)[C@H](C)C3)cc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H31N3O4S.C2H2O4/c1-17-11-18(26-12-21-23(33-2)6-4-8-25(21)35-26)9-10-30(17)14-19(32)15-34-24-7-3-5-22-20(24)13-27(29-22)28-16-31;3-1(4)2(5)6/h3-8,12-13,16-19,29,32H,9-11,14-15H2,1-2H3,(H,28,31);(H,3,4)(H,5,6)/t17-,18+,19+;/m1./s1 |
| InChIKey | MSFTYYAZJZRCNF-WXLIBGKBSA-N |
| XLogP | 4.12 |
| TPSA | 161.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|