C20H26F6N4O6 — CID 87888817
[(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethyl] N-ethylcarbamate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87888817) has the molecular formula C20H26F6N4O6 and a molecular weight of 532.44 g/mol. Its IUPAC name is [(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethyl] N-ethylcarbamate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethyl] N-ethylcarbamate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87888817 |
| Molecular Formula | C20H26F6N4O6 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethyl] N-ethylcarbamate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCNC(=O)O[C@@H](C)c1ccc2c(n1)N1[C@@H](CNC[C@H]1C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2.2C2HF3O2/c1-4-18-16(21)22-11(3)14-6-5-12-7-13-9-17-8-10(2)20(13)15(12)19-14;2*3-2(4,5)1(6)7/h5-6,10-11,13,17H,4,7-9H2,1-3H3,(H,18,21);2*(H,6,7)/t10-,11+,13-;;/m1../s1 |
| InChIKey | NBKQJKZRDWCCJI-VWJYOVQOSA-N |
| XLogP | 2.88 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |