C21H28F6N4O6 — CID 87888820
[(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethyl] N-propylcarbamate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87888820) has the molecular formula C21H28F6N4O6 and a molecular weight of 546.47 g/mol. Its IUPAC name is [(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethyl] N-propylcarbamate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethyl] N-propylcarbamate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87888820 |
| Molecular Formula | C21H28F6N4O6 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | [(1S)-1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]ethyl] N-propylcarbamate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCCNC(=O)O[C@@H](C)c1ccc2c(n1)N1[C@@H](CNC[C@H]1C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O2.2C2HF3O2/c1-4-7-19-17(22)23-12(3)15-6-5-13-8-14-10-18-9-11(2)21(14)16(13)20-15;2*3-2(4,5)1(6)7/h5-6,11-12,14,18H,4,7-10H2,1-3H3,(H,19,22);2*(H,6,7)/t11-,12+,14-;;/m1../s1 |
| InChIKey | RWQBAHQBHPPXSZ-UDPGNSCCSA-N |
| XLogP | 3.27 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |