About propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate
propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 87888826) has the molecular formula C12H20N2O5S
and a molecular weight of 304.37 g/mol. Its IUPAC name is propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate |
| PubChem CID | 87888826 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CCC(=O)OCOC(=O)N1C[C@@H](S)C[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C12H20N2O5S/c1-4-10(15)18-7-19-12(17)14-6-8(20)5-9(14)11(16)13(2)3/h8-9,20H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | HRDLNLIOCJUWQW-IUCAKERBSA-N |
| XLogP | 0.49 |
| TPSA | 76.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate?
The IUPAC name of propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate (CID 87888826) is propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate.
What is the SMILES notation for propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate?
The canonical SMILES for propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate is CCC(=O)OCOC(=O)N1C[C@@H](S)C[C@H]1C(=O)N(C)C.
What is the InChIKey of propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate?
The InChIKey is HRDLNLIOCJUWQW-IUCAKERBSA-N. The full InChI is InChI=1S/C12H20N2O5S/c1-4-10(15)18-7-19-12(17)14-6-8(20)5-9(14)11(16)13(2)3/h8-9,20H,4-7H2,1-3H3/t8-,9-/m0/s1.
What are the key properties of propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate?
propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate has a molecular weight of 304.37 g/mol, XLogP of 0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyloxymethyl (2S,4S)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate is sourced from PubChem (CID 87888826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).