C22H30F6N4O6 — CID 87888874
1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]butyl N-ethylcarbamate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87888874) has the molecular formula C22H30F6N4O6 and a molecular weight of 560.49 g/mol. Its IUPAC name is 1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]butyl N-ethylcarbamate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]butyl N-ethylcarbamate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87888874 |
| Molecular Formula | C22H30F6N4O6 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 1-[(9R,13R)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-trien-4-yl]butyl N-ethylcarbamate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCCC(OC(=O)NCC)c1ccc2c(n1)N1[C@@H](CNC[C@H]1C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O2.2C2HF3O2/c1-4-6-16(24-18(23)20-5-2)15-8-7-13-9-14-11-19-10-12(3)22(14)17(13)21-15;2*3-2(4,5)1(6)7/h7-8,12,14,16,19H,4-6,9-11H2,1-3H3,(H,20,23);2*(H,6,7)/t12-,14-,16?;;/m1../s1 |
| InChIKey | NRBTUCGNLGHOHG-GGSYEMDXSA-N |
| XLogP | 3.66 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |