C8F17N — CID 87889099
N,N,2,2,3,3,4,4,5,6,6-undecafluoro-1,5-bis(trifluoromethyl)cyclohexan-1-amine (PubChem CID 87889099) has the molecular formula C8F17N and a molecular weight of 433.06 g/mol. Its IUPAC name is N,N,2,2,3,3,4,4,5,6,6-undecafluoro-1,5-bis(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N,N,2,2,3,3,4,4,5,6,6-undecafluoro-1,5-bis(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 87889099 |
| Molecular Formula | C8F17N |
| Molecular Weight | 433.06 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | N,N,2,2,3,3,4,4,5,6,6-undecafluoro-1,5-bis(trifluoromethyl)cyclohexan-1-amine |
| SMILES | FN(F)C1(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C8F17N/c9-1(7(18,19)20)3(10,11)2(26(24)25,8(21,22)23)5(14,15)6(16,17)4(1,12)13 |
| InChIKey | HSROSWTVLYDGFH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.06 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|