C27H24ClF3N6O5 — CID 87889562
[2-[7-(2-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)-8-piperazin-1-ylpurin-3-yl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 87889562) has the molecular formula C27H24ClF3N6O5 and a molecular weight of 604.97 g/mol. Its IUPAC name is [2-[7-(2-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)-8-piperazin-1-ylpurin-3-yl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[7-(2-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)-8-piperazin-1-ylpurin-3-yl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87889562 |
| Molecular Formula | C27H24ClF3N6O5 |
| Molecular Weight | 604.97 g/mol |
| Exact Mass | 604.14 |
| IUPAC Name | [2-[7-(2-chlorophenyl)-2,6-dioxo-1-(2-phenylethyl)-8-piperazin-1-ylpurin-3-yl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Cn1c(=O)n(CCc2ccccc2)c(=O)c2c1nc(N1CCNCC1)n2-c1ccccc1Cl)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C27H24ClF3N6O5/c28-18-8-4-5-9-19(18)37-21-22(33-25(37)34-14-11-32-12-15-34)36(16-20(38)42-24(40)27(29,30)31)26(41)35(23(21)39)13-10-17-6-2-1-3-7-17/h1-9,32H,10-16H2 |
| InChIKey | GOPFIUPUJLFUGX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.97 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|