About N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride
N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride (PubChem CID 87890415) has the molecular formula C8H14ClF3N2O
and a molecular weight of 246.66 g/mol. Its IUPAC name is N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride |
| PubChem CID | 87890415 |
| Molecular Formula | C8H14ClF3N2O |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride |
| SMILES | Cl.O=C(NCCCC1CNC1)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O.ClH/c9-8(10,11)7(14)13-3-1-2-6-4-12-5-6;/h6,12H,1-5H2,(H,13,14);1H |
| InChIKey | MKQHCELEUBNUPW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride?
The IUPAC name of N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride (CID 87890415) is N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride.
What is the SMILES notation for N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride?
The canonical SMILES for N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride is Cl.O=C(NCCCC1CNC1)C(F)(F)F.
What is the InChIKey of N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride?
The InChIKey is MKQHCELEUBNUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O.ClH/c9-8(10,11)7(14)13-3-1-2-6-4-12-5-6;/h6,12H,1-5H2,(H,13,14);1H.
What are the key properties of N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride?
N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride has a molecular weight of 246.66 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(azetidin-3-yl)propyl]-2,2,2-trifluoroacetamide;hydrochloride is sourced from PubChem (CID 87890415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).