About 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium
1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium (PubChem CID 87890437) has the molecular formula C11H16N3OPd-
and a molecular weight of 312.69 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium |
| PubChem CID | 87890437 |
| Molecular Formula | C11H16N3OPd- |
| Molecular Weight | 312.69 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium |
| SMILES | CN(C)CCNC(=O)Nc1c[c-]ccc1.[Pd] |
| InChI | InChI=1S/C11H16N3O.Pd/c1-14(2)9-8-12-11(15)13-10-6-4-3-5-7-10;/h3-4,6-7H,8-9H2,1-2H3,(H2,12,13,15);/q-1; |
| InChIKey | VFEONZFINQUMMJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.69 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium?
The IUPAC name of 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium (CID 87890437) is 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium.
What is the SMILES notation for 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium?
The canonical SMILES for 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium is CN(C)CCNC(=O)Nc1c[c-]ccc1.[Pd].
What is the InChIKey of 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium?
The InChIKey is VFEONZFINQUMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N3O.Pd/c1-14(2)9-8-12-11(15)13-10-6-4-3-5-7-10;/h3-4,6-7H,8-9H2,1-2H3,(H2,12,13,15);/q-1;.
What are the key properties of 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium?
1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium has a molecular weight of 312.69 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)ethyl]-3-phenylurea;palladium is sourced from PubChem (CID 87890437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).