C23H16N2O4S2 — CID 87890527
(5-methylsulfanyl-11-oxo-8,14-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-9-yl) 4-methylbenzenesulfonate (PubChem CID 87890527) has the molecular formula C23H16N2O4S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is (5-methylsulfanyl-11-oxo-8,14-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-9-yl) 4-methylbenzenesulfonate.
| Compound Name | (5-methylsulfanyl-11-oxo-8,14-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-9-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87890527 |
| Molecular Formula | C23H16N2O4S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | (5-methylsulfanyl-11-oxo-8,14-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-9-yl) 4-methylbenzenesulfonate |
| SMILES | CSc1ccc2c3c(c(OS(=O)(=O)c4ccc(C)cc4)nc2c1)C(=O)c1cnccc1-3 |
| InChI | InChI=1S/C23H16N2O4S2/c1-13-3-6-15(7-4-13)31(27,28)29-23-21-20(16-9-10-24-12-18(16)22(21)26)17-8-5-14(30-2)11-19(17)25-23/h3-12H,1-2H3 |
| InChIKey | LWXCDXLOWLWJEC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|