About 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine
1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine (PubChem CID 87890572) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine.
Molecular Properties
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine |
| PubChem CID | 87890572 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine |
| SMILES | CCC1CCCCN1CC1=CCCC=C1 |
| InChI | InChI=1S/C14H23N/c1-2-14-10-6-7-11-15(14)12-13-8-4-3-5-9-13/h4,8-9,14H,2-3,5-7,10-12H2,1H3 |
| InChIKey | IRDRDHZOGIZZSU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine?
The IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine (CID 87890572) is 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine.
What is the SMILES notation for 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine?
The canonical SMILES for 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine is CCC1CCCCN1CC1=CCCC=C1.
What is the InChIKey of 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine?
The InChIKey is IRDRDHZOGIZZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N/c1-2-14-10-6-7-11-15(14)12-13-8-4-3-5-9-13/h4,8-9,14H,2-3,5-7,10-12H2,1H3.
What are the key properties of 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine?
1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine has a molecular weight of 205.34 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylpiperidine is sourced from PubChem (CID 87890572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).