C28H30F6N6O2 — CID 87890732
(2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-morpholin-4-ylpyrazin-2-yl]-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-amine (PubChem CID 87890732) has the molecular formula C28H30F6N6O2 and a molecular weight of 596.58 g/mol. Its IUPAC name is (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-morpholin-4-ylpyrazin-2-yl]-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-amine.
| Compound Name | (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-morpholin-4-ylpyrazin-2-yl]-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 87890732 |
| Molecular Formula | C28H30F6N6O2 |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-morpholin-4-ylpyrazin-2-yl]-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-amine |
| SMILES | CC[C@@H]1C[C@H](Nc2nc(N3CCOCC3)cnc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2nc(OC)ccc2N1 |
| InChI | InChI=1S/C28H30F6N6O2/c1-3-19-14-21(25-20(36-19)4-5-24(39-25)41-2)37-26-22(35-15-23(38-26)40-6-8-42-9-7-40)12-16-10-17(27(29,30)31)13-18(11-16)28(32,33)34/h4-5,10-11,13,15,19,21,36H,3,6-9,12,14H2,1-2H3,(H,37,38)/t19-,21+/m1/s1 |
| InChIKey | SGNKXDLJTWLUGA-CTNGQTDRSA-N |
| XLogP | 6.09 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |