C29H31F6N5O2 — CID 87890807
(2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-amine (PubChem CID 87890807) has the molecular formula C29H31F6N5O2 and a molecular weight of 595.59 g/mol. Its IUPAC name is (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-amine.
| Compound Name | (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 87890807 |
| Molecular Formula | C29H31F6N5O2 |
| Molecular Weight | 595.59 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-amine |
| SMILES | CC[C@@H]1C[C@H](Nc2ncc(N3CCOCC3)cc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2nc(OC)ccc2N1 |
| InChI | InChI=1S/C29H31F6N5O2/c1-3-21-15-24(26-23(37-21)4-5-25(39-26)41-2)38-27-18(13-22(16-36-27)40-6-8-42-9-7-40)10-17-11-19(28(30,31)32)14-20(12-17)29(33,34)35/h4-5,11-14,16,21,24,37H,3,6-10,15H2,1-2H3,(H,36,38)/t21-,24+/m1/s1 |
| InChIKey | LRHVFBINONIMMF-QPPBQGQZSA-N |
| XLogP | 6.70 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |