C10H17N3O5 — CID 87891226
2-[[(4S)-4,7-diamino-2-methyl-3,7-dioxoheptanoyl]amino]acetic acid (PubChem CID 87891226) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[[(4S)-4,7-diamino-2-methyl-3,7-dioxoheptanoyl]amino]acetic acid.
| Compound Name | 2-[[(4S)-4,7-diamino-2-methyl-3,7-dioxoheptanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 87891226 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[[(4S)-4,7-diamino-2-methyl-3,7-dioxoheptanoyl]amino]acetic acid |
| SMILES | CC(C(=O)NCC(=O)O)C(=O)[C@@H](N)CCC(N)=O |
| InChI | InChI=1S/C10H17N3O5/c1-5(10(18)13-4-8(15)16)9(17)6(11)2-3-7(12)14/h5-6H,2-4,11H2,1H3,(H2,12,14)(H,13,18)(H,15,16)/t5?,6-/m0/s1 |
| InChIKey | OBYDCRLMOCDTGT-GDVGLLTNSA-N |
| XLogP | -2.01 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|