C13H14FNO — CID 87891548
6-fluoro-2,3,4,4a,9,9a-hexahydro-1H-carbazole-3-carbaldehyde (PubChem CID 87891548) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is 6-fluoro-2,3,4,4a,9,9a-hexahydro-1H-carbazole-3-carbaldehyde.
| Compound Name | 6-fluoro-2,3,4,4a,9,9a-hexahydro-1H-carbazole-3-carbaldehyde |
|---|---|
| PubChem CID | 87891548 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-fluoro-2,3,4,4a,9,9a-hexahydro-1H-carbazole-3-carbaldehyde |
| SMILES | O=CC1CCC2Nc3ccc(F)cc3C2C1 |
| InChI | InChI=1S/C13H14FNO/c14-9-2-4-13-11(6-9)10-5-8(7-16)1-3-12(10)15-13/h2,4,6-8,10,12,15H,1,3,5H2 |
| InChIKey | UTKSZTNCMXPYCI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|