About 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid
3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid (PubChem CID 87891565) has the molecular formula C10H7Cl2N3O2S
and a molecular weight of 304.16 g/mol. Its IUPAC name is 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid |
| PubChem CID | 87891565 |
| Molecular Formula | C10H7Cl2N3O2S |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1NCc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C10H7Cl2N3O2S/c11-7-3-5(14-10(12)15-7)4-13-6-1-2-18-8(6)9(16)17/h1-3,13H,4H2,(H,16,17) |
| InChIKey | UUAIQLQOLUNYJP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid?
The IUPAC name of 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid (CID 87891565) is 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid.
What is the SMILES notation for 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid?
The canonical SMILES for 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid is O=C(O)c1sccc1NCc1cc(Cl)nc(Cl)n1.
What is the InChIKey of 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid?
The InChIKey is UUAIQLQOLUNYJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3O2S/c11-7-3-5(14-10(12)15-7)4-13-6-1-2-18-8(6)9(16)17/h1-3,13H,4H2,(H,16,17).
What are the key properties of 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid?
3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid has a molecular weight of 304.16 g/mol, XLogP of 3.16, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichloropyrimidin-4-yl)methylamino]thiophene-2-carboxylic acid is sourced from PubChem (CID 87891565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).