2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid

C9H10F6O4 — CID 87891825

IUPAC2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid
SMILESO=C(O)CCC(CC(F)(F)F)(CC(F)(F)F)C(=O)O
InChIInChI=1S/C9H10F6O4/c10-8(11,12)3-7(6(18)19,2-1-5(16)17)4-9(13,14)15/h1-4H2,(H,16,17)(H,18,19)
InChIKeyWMLOFVUNTZMACW-UHFFFAOYSA-N
MW296.16 g/mol
LogP2.83
Rot. Bonds6

About 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid

2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid (PubChem CID 87891825) has the molecular formula C9H10F6O4 and a molecular weight of 296.16 g/mol. Its IUPAC name is 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid.

Molecular Properties

Compound Name2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid
PubChem CID87891825
Molecular FormulaC9H10F6O4
Molecular Weight296.16 g/mol
Exact Mass296.05
IUPAC Name2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid
SMILESO=C(O)CCC(CC(F)(F)F)(CC(F)(F)F)C(=O)O
InChIInChI=1S/C9H10F6O4/c10-8(11,12)3-7(6(18)19,2-1-5(16)17)4-9(13,14)15/h1-4H2,(H,16,17)(H,18,19)
InChIKeyWMLOFVUNTZMACW-UHFFFAOYSA-N
XLogP2.83
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.16
LogP ≤ 52.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid?
The IUPAC name of 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid (CID 87891825) is 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid.
What is the SMILES notation for 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid?
The canonical SMILES for 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid is O=C(O)CCC(CC(F)(F)F)(CC(F)(F)F)C(=O)O.
What is the InChIKey of 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid?
The InChIKey is WMLOFVUNTZMACW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F6O4/c10-8(11,12)3-7(6(18)19,2-1-5(16)17)4-9(13,14)15/h1-4H2,(H,16,17)(H,18,19).
What are the key properties of 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid?
2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid has a molecular weight of 296.16 g/mol, XLogP of 2.83, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2,2,2-trifluoroethyl)pentanedioic acid is sourced from PubChem (CID 87891825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).