C10H17F5O3S — CID 87892032
1-(4,4,5,5,5-pentafluoropentan-2-ylsulfonyl)pentan-2-ol (PubChem CID 87892032) has the molecular formula C10H17F5O3S and a molecular weight of 312.30 g/mol. Its IUPAC name is 1-(4,4,5,5,5-pentafluoropentan-2-ylsulfonyl)pentan-2-ol.
| Compound Name | 1-(4,4,5,5,5-pentafluoropentan-2-ylsulfonyl)pentan-2-ol |
|---|---|
| PubChem CID | 87892032 |
| Molecular Formula | C10H17F5O3S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(4,4,5,5,5-pentafluoropentan-2-ylsulfonyl)pentan-2-ol |
| SMILES | CCCC(O)CS(=O)(=O)C(C)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H17F5O3S/c1-3-4-8(16)6-19(17,18)7(2)5-9(11,12)10(13,14)15/h7-8,16H,3-6H2,1-2H3 |
| InChIKey | BOHHPDACUFJFTO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|