C41H30Cl2F6N8O2S2 — CID 87892177
1-(4-chlorophenyl)-9-phenyl-2-(4,4,4-trifluorobutylsulfanyl)purin-6-one;1-(4-chlorophenyl)-9-phenyl-2-(3,3,3-trifluoropropylsulfanyl)purin-6-one (PubChem CID 87892177) has the molecular formula C41H30Cl2F6N8O2S2 and a molecular weight of 915.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-9-phenyl-2-(4,4,4-trifluorobutylsulfanyl)purin-6-one;1-(4-chlorophenyl)-9-phenyl-2-(3,3,3-trifluoropropylsulfanyl)purin-6-one.
| Compound Name | 1-(4-chlorophenyl)-9-phenyl-2-(4,4,4-trifluorobutylsulfanyl)purin-6-one;1-(4-chlorophenyl)-9-phenyl-2-(3,3,3-trifluoropropylsulfanyl)purin-6-one |
|---|---|
| PubChem CID | 87892177 |
| Molecular Formula | C41H30Cl2F6N8O2S2 |
| Molecular Weight | 915.77 g/mol |
| Exact Mass | 914.12 |
| IUPAC Name | 1-(4-chlorophenyl)-9-phenyl-2-(4,4,4-trifluorobutylsulfanyl)purin-6-one;1-(4-chlorophenyl)-9-phenyl-2-(3,3,3-trifluoropropylsulfanyl)purin-6-one |
| SMILES | O=c1c2ncn(-c3ccccc3)c2nc(SCCC(F)(F)F)n1-c1ccc(Cl)cc1.O=c1c2ncn(-c3ccccc3)c2nc(SCCCC(F)(F)F)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClF3N4OS.C20H14ClF3N4OS/c22-14-7-9-16(10-8-14)29-19(30)17-18(27-20(29)31-12-4-11-21(23,24)25)28(13-26-17)15-5-2-1-3-6-15;21-13-6-8-15(9-7-13)28-18(29)16-17(26-19(28)30-11-10-20(22,23)24)27(12-25-16)14-4-2-1-3-5-14/h1-3,5-10,13H,4,11-12H2;1-9,12H,10-11H2 |
| InChIKey | WTARNVBHMNVUHU-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 105.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.77 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|