About 1-fluorocarbazol-4-one
1-fluorocarbazol-4-one (PubChem CID 87892356) has the molecular formula C12H6FNO
and a molecular weight of 199.18 g/mol. Its IUPAC name is 1-fluorocarbazol-4-one.
Molecular Properties
| Compound Name | 1-fluorocarbazol-4-one |
| PubChem CID | 87892356 |
| Molecular Formula | C12H6FNO |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1-fluorocarbazol-4-one |
| SMILES | O=C1C=CC(F)=C2N=c3ccccc3=C12 |
| InChI | InChI=1S/C12H6FNO/c13-8-5-6-10(15)11-7-3-1-2-4-9(7)14-12(8)11/h1-6H |
| InChIKey | UIEJHMXBNFHDNT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluorocarbazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorocarbazol-4-one?
The IUPAC name of 1-fluorocarbazol-4-one (CID 87892356) is 1-fluorocarbazol-4-one.
What is the SMILES notation for 1-fluorocarbazol-4-one?
The canonical SMILES for 1-fluorocarbazol-4-one is O=C1C=CC(F)=C2N=c3ccccc3=C12.
What is the InChIKey of 1-fluorocarbazol-4-one?
The InChIKey is UIEJHMXBNFHDNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6FNO/c13-8-5-6-10(15)11-7-3-1-2-4-9(7)14-12(8)11/h1-6H.
What are the key properties of 1-fluorocarbazol-4-one?
1-fluorocarbazol-4-one has a molecular weight of 199.18 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorocarbazol-4-one is sourced from PubChem (CID 87892356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).