C14H30O2 — CID 87893087
2,4,6,8-tetramethyldecane-1,8-diol (PubChem CID 87893087) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is 2,4,6,8-tetramethyldecane-1,8-diol.
| Compound Name | 2,4,6,8-tetramethyldecane-1,8-diol |
|---|---|
| PubChem CID | 87893087 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 2,4,6,8-tetramethyldecane-1,8-diol |
| SMILES | CCC(C)(O)CC(C)CC(C)CC(C)CO |
| InChI | InChI=1S/C14H30O2/c1-6-14(5,16)9-12(3)7-11(2)8-13(4)10-15/h11-13,15-16H,6-10H2,1-5H3 |
| InChIKey | LIYVWOSMXZLGMH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |