About dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane
dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane (PubChem CID 87893678) has the molecular formula C6H13N2O3PS3
and a molecular weight of 288.36 g/mol. Its IUPAC name is dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane |
| PubChem CID | 87893678 |
| Molecular Formula | C6H13N2O3PS3 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane |
| SMILES | COC1=NN(CSP(=S)(OC)OC)CS1 |
| InChI | InChI=1S/C6H13N2O3PS3/c1-9-6-7-8(4-14-6)5-15-12(13,10-2)11-3/h4-5H2,1-3H3 |
| InChIKey | NXZQBJOVHSUGLD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane?
The IUPAC name of dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane (CID 87893678) is dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane.
What is the SMILES notation for dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane?
The canonical SMILES for dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is COC1=NN(CSP(=S)(OC)OC)CS1.
What is the InChIKey of dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane?
The InChIKey is NXZQBJOVHSUGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N2O3PS3/c1-9-6-7-8(4-14-6)5-15-12(13,10-2)11-3/h4-5H2,1-3H3.
What are the key properties of dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane?
dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane has a molecular weight of 288.36 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-[(5-methoxy-2H-1,3,4-thiadiazol-3-yl)methylsulfanyl]-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 87893678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).