C32H35F6N3O2 — CID 87894732
N-[3-[3-[4-[2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethyl]piperazin-1-yl]phenyl]propyl]acetamide (PubChem CID 87894732) has the molecular formula C32H35F6N3O2 and a molecular weight of 607.64 g/mol. Its IUPAC name is N-[3-[3-[4-[2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethyl]piperazin-1-yl]phenyl]propyl]acetamide.
| Compound Name | N-[3-[3-[4-[2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethyl]piperazin-1-yl]phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 87894732 |
| Molecular Formula | C32H35F6N3O2 |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | N-[3-[3-[4-[2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]ethyl]piperazin-1-yl]phenyl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1cccc(N2CCN(CCc3ccccc3OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C32H35F6N3O2/c1-23(42)39-12-5-7-24-6-4-9-29(20-24)41-16-14-40(15-17-41)13-11-26-8-2-3-10-30(26)43-22-25-18-27(31(33,34)35)21-28(19-25)32(36,37)38/h2-4,6,8-10,18-21H,5,7,11-17,22H2,1H3,(H,39,42) |
| InChIKey | SQWBKBYRGYUROI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|