About 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium
2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium (PubChem CID 87894734) has the molecular formula C41H90N2O2+2
and a molecular weight of 643.18 g/mol. Its IUPAC name is 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium.
Molecular Properties
| Compound Name | 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium |
| PubChem CID | 87894734 |
| Molecular Formula | C41H90N2O2+2 |
| Molecular Weight | 643.18 g/mol |
| Exact Mass | 642.70 |
| IUPAC Name | 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium |
| SMILES | CCCCCCCC[N+](CCO)(CCCCCCCC)CCCCCCCC.CCCC[N+](CCCC)(CCCC)CC(C)O |
| InChI | InChI=1S/C26H56NO.C15H34NO/c1-4-7-10-13-16-19-22-27(25-26-28,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-5-8-11-16(12-9-6-2,13-10-7-3)14-15(4)17/h28H,4-26H2,1-3H3;15,17H,5-14H2,1-4H3/q2*+1 |
| InChIKey | XXCPWHYNCRRGGU-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.18 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium?
The IUPAC name of 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium (CID 87894734) is 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium.
What is the SMILES notation for 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium?
The canonical SMILES for 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium is CCCCCCCC[N+](CCO)(CCCCCCCC)CCCCCCCC.CCCC[N+](CCCC)(CCCC)CC(C)O.
What is the InChIKey of 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium?
The InChIKey is XXCPWHYNCRRGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H56NO.C15H34NO/c1-4-7-10-13-16-19-22-27(25-26-28,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-5-8-11-16(12-9-6-2,13-10-7-3)14-15(4)17/h28H,4-26H2,1-3H3;15,17H,5-14H2,1-4H3/q2*+1.
What are the key properties of 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium?
2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium has a molecular weight of 643.18 g/mol, XLogP of 11.46, 34 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl(trioctyl)azanium;tributyl(2-hydroxypropyl)azanium is sourced from PubChem (CID 87894734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).