C15H23F3 — CID 87895276
(6E,10E)-2,6-dimethyl-10-(trifluoromethyl)dodeca-2,6,10-triene (PubChem CID 87895276) has the molecular formula C15H23F3 and a molecular weight of 260.34 g/mol. Its IUPAC name is (6E,10E)-2,6-dimethyl-10-(trifluoromethyl)dodeca-2,6,10-triene.
| Compound Name | (6E,10E)-2,6-dimethyl-10-(trifluoromethyl)dodeca-2,6,10-triene |
|---|---|
| PubChem CID | 87895276 |
| Molecular Formula | C15H23F3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (6E,10E)-2,6-dimethyl-10-(trifluoromethyl)dodeca-2,6,10-triene |
| SMILES | C/C=C(\CC/C=C(\C)CCC=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H23F3/c1-5-14(15(16,17)18)11-7-10-13(4)9-6-8-12(2)3/h5,8,10H,6-7,9,11H2,1-4H3/b13-10+,14-5+ |
| InChIKey | GJICYOISLNLHKQ-NCLYQNMFSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|