About 1,1,2-trichloroethene;1,2-xylene
1,1,2-trichloroethene;1,2-xylene (PubChem CID 87895768) has the molecular formula C10H11Cl3
and a molecular weight of 237.56 g/mol. Its IUPAC name is 1,1,2-trichloroethene;1,2-xylene.
Molecular Properties
| Compound Name | 1,1,2-trichloroethene;1,2-xylene |
| PubChem CID | 87895768 |
| Molecular Formula | C10H11Cl3 |
| Molecular Weight | 237.56 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 1,1,2-trichloroethene;1,2-xylene |
| SMILES | Cc1ccccc1C.ClC=C(Cl)Cl |
| InChI | InChI=1S/C8H10.C2HCl3/c1-7-5-3-4-6-8(7)2;3-1-2(4)5/h3-6H,1-2H3;1H |
| InChIKey | QWXDWYIYOSPPHJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1,2-trichloroethene;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trichloroethene;1,2-xylene?
The IUPAC name of 1,1,2-trichloroethene;1,2-xylene (CID 87895768) is 1,1,2-trichloroethene;1,2-xylene.
What is the SMILES notation for 1,1,2-trichloroethene;1,2-xylene?
The canonical SMILES for 1,1,2-trichloroethene;1,2-xylene is Cc1ccccc1C.ClC=C(Cl)Cl.
What is the InChIKey of 1,1,2-trichloroethene;1,2-xylene?
The InChIKey is QWXDWYIYOSPPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C2HCl3/c1-7-5-3-4-6-8(7)2;3-1-2(4)5/h3-6H,1-2H3;1H.
What are the key properties of 1,1,2-trichloroethene;1,2-xylene?
1,1,2-trichloroethene;1,2-xylene has a molecular weight of 237.56 g/mol, XLogP of 4.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trichloroethene;1,2-xylene is sourced from PubChem (CID 87895768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).