C21H24AsClFN3O — CID 87895810
CID 87895810 (PubChem CID 87895810) has the molecular formula C21H24AsClFN3O and a molecular weight of 463.82 g/mol.
| Compound Name | CID 87895810 |
|---|---|
| PubChem CID | 87895810 |
| Molecular Formula | C21H24AsClFN3O |
| Molecular Weight | 463.82 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | — |
| SMILES | COC[C@H](CF)n1cc(C)c2nc(-c3ccc(C(C)C)nc3C[As])c(Cl)cc21 |
| InChI | InChI=1S/C21H24AsClFN3O/c1-12(2)17-6-5-15(18(8-22)25-17)21-16(23)7-19-20(26-21)13(3)10-27(19)14(9-24)11-28-4/h5-7,10,12,14H,8-9,11H2,1-4H3/t14-/m0/s1 |
| InChIKey | QZQNJWLHIFBFKN-AWEZNQCLSA-N |
| XLogP | 5.01 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.82 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|