About N-oct-1-en-3-ylacetamide
N-oct-1-en-3-ylacetamide (PubChem CID 87897341) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is N-oct-1-en-3-ylacetamide.
Molecular Properties
| Compound Name | N-oct-1-en-3-ylacetamide |
| PubChem CID | 87897341 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-oct-1-en-3-ylacetamide |
| SMILES | C=CC(CCCCC)NC(C)=O |
| InChI | InChI=1S/C10H19NO/c1-4-6-7-8-10(5-2)11-9(3)12/h5,10H,2,4,6-8H2,1,3H3,(H,11,12) |
| InChIKey | NEZIMTIKJPHBTO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-oct-1-en-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oct-1-en-3-ylacetamide?
The IUPAC name of N-oct-1-en-3-ylacetamide (CID 87897341) is N-oct-1-en-3-ylacetamide.
What is the SMILES notation for N-oct-1-en-3-ylacetamide?
The canonical SMILES for N-oct-1-en-3-ylacetamide is C=CC(CCCCC)NC(C)=O.
What is the InChIKey of N-oct-1-en-3-ylacetamide?
The InChIKey is NEZIMTIKJPHBTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-4-6-7-8-10(5-2)11-9(3)12/h5,10H,2,4,6-8H2,1,3H3,(H,11,12).
What are the key properties of N-oct-1-en-3-ylacetamide?
N-oct-1-en-3-ylacetamide has a molecular weight of 169.27 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-oct-1-en-3-ylacetamide is sourced from PubChem (CID 87897341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).