About (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal
(2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal (PubChem CID 87897708) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal.
Molecular Properties
| Compound Name | (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal |
| PubChem CID | 87897708 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal |
| SMILES | COc1ccc(C2OC[C@H](C)[C@@H]([C@@H](C)C=O)O2)cc1 |
| InChI | InChI=1S/C15H20O4/c1-10(8-16)14-11(2)9-18-15(19-14)12-4-6-13(17-3)7-5-12/h4-8,10-11,14-15H,9H2,1-3H3/t10-,11-,14+,15?/m0/s1 |
| InChIKey | KABAFRYLLDSUCR-YNWUBMQCSA-N |
| XLogP | 2.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal?
The IUPAC name of (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal (CID 87897708) is (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal.
What is the SMILES notation for (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal?
The canonical SMILES for (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal is COc1ccc(C2OC[C@H](C)[C@@H]([C@@H](C)C=O)O2)cc1.
What is the InChIKey of (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal?
The InChIKey is KABAFRYLLDSUCR-YNWUBMQCSA-N. The full InChI is InChI=1S/C15H20O4/c1-10(8-16)14-11(2)9-18-15(19-14)12-4-6-13(17-3)7-5-12/h4-8,10-11,14-15H,9H2,1-3H3/t10-,11-,14+,15?/m0/s1.
What are the key properties of (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal?
(2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal has a molecular weight of 264.32 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(4S,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propanal is sourced from PubChem (CID 87897708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).