About 6-sulfonyl-5,7-dihydrochromene
6-sulfonyl-5,7-dihydrochromene (PubChem CID 87897737) has the molecular formula C9H8O3S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 6-sulfonyl-5,7-dihydrochromene.
Molecular Properties
| Compound Name | 6-sulfonyl-5,7-dihydrochromene |
| PubChem CID | 87897737 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 6-sulfonyl-5,7-dihydrochromene |
| SMILES | O=S(=O)=C1CC=C2OC=CC=C2C1 |
| InChI | InChI=1S/C9H8O3S/c10-13(11)8-3-4-9-7(6-8)2-1-5-12-9/h1-2,4-5H,3,6H2 |
| InChIKey | JNMVNIFLWVOSII-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfonyl-5,7-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfonyl-5,7-dihydrochromene?
The IUPAC name of 6-sulfonyl-5,7-dihydrochromene (CID 87897737) is 6-sulfonyl-5,7-dihydrochromene.
What is the SMILES notation for 6-sulfonyl-5,7-dihydrochromene?
The canonical SMILES for 6-sulfonyl-5,7-dihydrochromene is O=S(=O)=C1CC=C2OC=CC=C2C1.
What is the InChIKey of 6-sulfonyl-5,7-dihydrochromene?
The InChIKey is JNMVNIFLWVOSII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S/c10-13(11)8-3-4-9-7(6-8)2-1-5-12-9/h1-2,4-5H,3,6H2.
What are the key properties of 6-sulfonyl-5,7-dihydrochromene?
6-sulfonyl-5,7-dihydrochromene has a molecular weight of 196.23 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfonyl-5,7-dihydrochromene is sourced from PubChem (CID 87897737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).