About 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene
6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene (PubChem CID 87898238) has the molecular formula C12H18F4O2S
and a molecular weight of 302.33 g/mol. Its IUPAC name is 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene.
Molecular Properties
| Compound Name | 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene |
| PubChem CID | 87898238 |
| Molecular Formula | C12H18F4O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene |
| SMILES | O=S(=O)(CCCCC=C(F)F)CCCCC=C(F)F |
| InChI | InChI=1S/C12H18F4O2S/c13-11(14)7-3-1-5-9-19(17,18)10-6-2-4-8-12(15)16/h7-8H,1-6,9-10H2 |
| InChIKey | MDKUFWBRPHFBOB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene?
The IUPAC name of 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene (CID 87898238) is 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene.
What is the SMILES notation for 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene?
The canonical SMILES for 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene is O=S(=O)(CCCCC=C(F)F)CCCCC=C(F)F.
What is the InChIKey of 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene?
The InChIKey is MDKUFWBRPHFBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F4O2S/c13-11(14)7-3-1-5-9-19(17,18)10-6-2-4-8-12(15)16/h7-8H,1-6,9-10H2.
What are the key properties of 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene?
6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene has a molecular weight of 302.33 g/mol, XLogP of 4.30, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6,6-difluorohex-5-enylsulfonyl)-1,1-difluorohex-1-ene is sourced from PubChem (CID 87898238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).