About CID 87898441
CID 87898441 (PubChem CID 87898441) has the molecular formula C17H10AsN3OS
and a molecular weight of 379.28 g/mol.
Molecular Properties
| Compound Name | CID 87898441 |
| PubChem CID | 87898441 |
| Molecular Formula | C17H10AsN3OS |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | — |
| SMILES | O=C(c1cccs1)c1cnn2c(-c3cccc([As])c3)ccnc12 |
| InChI | InChI=1S/C17H10AsN3OS/c18-12-4-1-3-11(9-12)14-6-7-19-17-13(10-20-21(14)17)16(22)15-5-2-8-23-15/h1-10H |
| InChIKey | XKXKYUJTQWDPDI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87898441 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87898441?
The IUPAC name of CID 87898441 (CID 87898441) is not available.
What is the SMILES notation for CID 87898441?
The canonical SMILES for CID 87898441 is O=C(c1cccs1)c1cnn2c(-c3cccc([As])c3)ccnc12.
What is the InChIKey of CID 87898441?
The InChIKey is XKXKYUJTQWDPDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10AsN3OS/c18-12-4-1-3-11(9-12)14-6-7-19-17-13(10-20-21(14)17)16(22)15-5-2-8-23-15/h1-10H.
What are the key properties of CID 87898441?
CID 87898441 has a molecular weight of 379.28 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87898441 is sourced from PubChem (CID 87898441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).