C15H13ClO3 — CID 87898633
2-chloro-3-hydroxy-3,3-diphenylpropanoic acid (PubChem CID 87898633) has the molecular formula C15H13ClO3 and a molecular weight of 276.72 g/mol. Its IUPAC name is 2-chloro-3-hydroxy-3,3-diphenylpropanoic acid.
| Compound Name | 2-chloro-3-hydroxy-3,3-diphenylpropanoic acid |
|---|---|
| PubChem CID | 87898633 |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-chloro-3-hydroxy-3,3-diphenylpropanoic acid |
| SMILES | O=C(O)C(Cl)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13ClO3/c16-13(14(17)18)15(19,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,19H,(H,17,18) |
| InChIKey | DTXTYVBIBIZFAV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|