About 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid
1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid (PubChem CID 87899019) has the molecular formula C21H29F3O7S2
and a molecular weight of 514.58 g/mol. Its IUPAC name is 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid |
| PubChem CID | 87899019 |
| Molecular Formula | C21H29F3O7S2 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid |
| SMILES | CCCCOc1ccc2c(OCCCC)ccc(CS(C)(=O)=O)c2c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C20H28O4S.CHF3O3S/c1-4-6-12-23-17-9-10-18-19(14-17)16(15-25(3,21)22)8-11-20(18)24-13-7-5-2;2-1(3,4)8(5,6)7/h8-11,14H,4-7,12-13,15H2,1-3H3;(H,5,6,7) |
| InChIKey | AXZCFTGPSBWHMY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid?
The IUPAC name of 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid (CID 87899019) is 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid.
What is the SMILES notation for 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid?
The canonical SMILES for 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid is CCCCOc1ccc2c(OCCCC)ccc(CS(C)(=O)=O)c2c1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid?
The InChIKey is AXZCFTGPSBWHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O4S.CHF3O3S/c1-4-6-12-23-17-9-10-18-19(14-17)16(15-25(3,21)22)8-11-20(18)24-13-7-5-2;2-1(3,4)8(5,6)7/h8-11,14H,4-7,12-13,15H2,1-3H3;(H,5,6,7).
What are the key properties of 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid?
1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid has a molecular weight of 514.58 g/mol, XLogP of 5.14, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dibutoxy-4-(methylsulfonylmethyl)naphthalene;trifluoromethanesulfonic acid is sourced from PubChem (CID 87899019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).