C23H54O10Si6 — CID 87900034
2-methylprop-2-enoyl 2,3-dihydroxy-2-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]hexanoate (PubChem CID 87900034) has the molecular formula C23H54O10Si6 and a molecular weight of 659.19 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2,3-dihydroxy-2-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]hexanoate.
| Compound Name | 2-methylprop-2-enoyl 2,3-dihydroxy-2-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]hexanoate |
|---|---|
| PubChem CID | 87900034 |
| Molecular Formula | C23H54O10Si6 |
| Molecular Weight | 659.19 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | 2-methylprop-2-enoyl 2,3-dihydroxy-2-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]hexanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)(C(O)CCC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H54O10Si6/c1-17-18-20(24)23(27,22(26)28-21(25)19(2)3)39(31-36(10,11)12,32-37(13,14)15)33-38(16,29-34(4,5)6)30-35(7,8)9/h20,24,27H,2,17-18H2,1,3-16H3 |
| InChIKey | OZPVMNYWGADMCV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.19 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|