C9F19N — CID 87900051
2,2,3,3,4,4,5,6,6-nonafluoro-1-(1,1,2,2,3,3,3-heptafluoropropyl)-5-(trifluoromethyl)piperidine (PubChem CID 87900051) has the molecular formula C9F19N and a molecular weight of 483.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,6,6-nonafluoro-1-(1,1,2,2,3,3,3-heptafluoropropyl)-5-(trifluoromethyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,6,6-nonafluoro-1-(1,1,2,2,3,3,3-heptafluoropropyl)-5-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 87900051 |
| Molecular Formula | C9F19N |
| Molecular Weight | 483.07 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | 2,2,3,3,4,4,5,6,6-nonafluoro-1-(1,1,2,2,3,3,3-heptafluoropropyl)-5-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C9F19N/c10-1(5(17,18)19)2(11,12)3(13,14)8(25,26)29(7(1,23)24)9(27,28)4(15,16)6(20,21)22 |
| InChIKey | ZSRHCUVWKKUXMF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.07 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|