About prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate
prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate (PubChem CID 87900055) has the molecular formula C18H40O8Si4
and a molecular weight of 496.85 g/mol. Its IUPAC name is prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate.
Molecular Properties
| Compound Name | prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate |
| PubChem CID | 87900055 |
| Molecular Formula | C18H40O8Si4 |
| Molecular Weight | 496.85 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate |
| SMILES | C=CC(=O)OC(=O)C(O)(C(O)CCC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H40O8Si4/c1-12-14-15(19)18(22,17(21)23-16(20)13-2)30(24-27(3,4)5,25-28(6,7)8)26-29(9,10)11/h13,15,19,22H,2,12,14H2,1,3-11H3 |
| InChIKey | GRACNOGDPNTKEH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.85 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate?
The IUPAC name of prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate (CID 87900055) is prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate.
What is the SMILES notation for prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate?
The canonical SMILES for prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate is C=CC(=O)OC(=O)C(O)(C(O)CCC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate?
The InChIKey is GRACNOGDPNTKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40O8Si4/c1-12-14-15(19)18(22,17(21)23-16(20)13-2)30(24-27(3,4)5,25-28(6,7)8)26-29(9,10)11/h13,15,19,22H,2,12,14H2,1,3-11H3.
What are the key properties of prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate?
prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate has a molecular weight of 496.85 g/mol, XLogP of 3.17, 12 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoyl 2,3-dihydroxy-2-tris(trimethylsilyloxy)silylhexanoate is sourced from PubChem (CID 87900055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).