About 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate
2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate (PubChem CID 87900096) has the molecular formula C15H30O6Si2
and a molecular weight of 362.57 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate |
| PubChem CID | 87900096 |
| Molecular Formula | C15H30O6Si2 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)(C(O)CCC)[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O6Si2/c1-9-10-12(16)15(19,14(18)20-13(17)11(2)3)23(7,8)21-22(4,5)6/h12,16,19H,2,9-10H2,1,3-8H3 |
| InChIKey | KZLLMZSIKIZNNE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate?
The IUPAC name of 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate (CID 87900096) is 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate.
What is the SMILES notation for 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate?
The canonical SMILES for 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate is C=C(C)C(=O)OC(=O)C(O)(C(O)CCC)[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate?
The InChIKey is KZLLMZSIKIZNNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O6Si2/c1-9-10-12(16)15(19,14(18)20-13(17)11(2)3)23(7,8)21-22(4,5)6/h12,16,19H,2,9-10H2,1,3-8H3.
What are the key properties of 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate?
2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate has a molecular weight of 362.57 g/mol, XLogP of 2.12, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoyl 2-[dimethyl(trimethylsilyloxy)silyl]-2,3-dihydroxyhexanoate is sourced from PubChem (CID 87900096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).